Products 913517-30-3
CAS 913517-30-3 is the registry number for 2-((4-(5-chloro-2-methylphenyl)piperazinyl)carbonyl)cyclopropanecarboxylic acid. Offered by: Biosynth. Available pack sizes: 250mg.
2-[4-(5-chloro-2-methylphenyl)piperazine-1-carbonyl]cyclopropane-1-carboxylic acid (CAS 913517-30-3) is a chemical compound with the molecular formula C16H19ClN2O3 and a molecular weight of 322.78 g/mol. IUPAC name: 2-[4-(5-chloro-2-methylphenyl)piperazine-1-carbonyl]cyclopropane-1-carboxylic acid. InChIKey: VCKBZBBAHJLSJZ-UHFFFAOYSA-N.
| Molecular formula | C16H19ClN2O3 |
|---|---|
| Molecular weight | 322.78 g/mol |
| IUPAC name | 2-[4-(5-chloro-2-methylphenyl)piperazine-1-carbonyl]cyclopropane-1-carboxylic acid |
| InChIKey | VCKBZBBAHJLSJZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)Cl)N2CCN(CC2)C(=O)C3CC3C(=O)O |
Computed by PubChem (NCBI)