CAS 913528-04-8 appears in our catalog under these names: DOTAM–mono–acid, DOTAM-mono-acid 95%, 2-(4,7,10-Tris(2-amino-2-oxoethyl)-1,4,7,10-tetraazacyclododecan-1-yl)acetic acid, 95%, 95%, DOTAM-mono-acid, 99.90%, DOTAM-mono-acid, 98%. Offered by: GLPBio, Ambeed, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 5mg, 100mg, 50mg, 250mg, 1g, 100 mg, 50 mg, 25 mg.
2-[4,7,10-tris(2-amino-2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (CAS 913528-04-8) is a chemical compound with the molecular formula C16H31N7O5 and a molecular weight of 401.46 g/mol. IUPAC name: 2-[4,7,10-tris(2-amino-2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid. InChIKey: DFPHZEYJGWLQJE-UHFFFAOYSA-N.
| Molecular formula | C16H31N7O5 |
|---|---|
| Molecular weight | 401.46 g/mol |
| IUPAC name | 2-[4,7,10-tris(2-amino-2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| InChIKey | DFPHZEYJGWLQJE-UHFFFAOYSA-N |
| SMILES | C1CN(CCN(CCN(CCN1CC(=O)N)CC(=O)N)CC(=O)O)CC(=O)N |
Computed by PubChem (NCBI)