Products 913575-12-9

CAS 913575-12-9 is the registry number for 3-Hydroxyimino-8-aza-bicyclo[3.2.1]octane-8-carboxylic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Tert-butyl 3-hydroxyimino-8-azabicyclo[3.2.1]octane-8-carboxylate (CAS 913575-12-9) is a chemical compound with the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. IUPAC name: tert-butyl 3-hydroxyimino-8-azabicyclo[3.2.1]octane-8-carboxylate. InChIKey: QCPJJHMDEDMYKA-UHFFFAOYSA-N.

Identity
Molecular formulaC12H20N2O3
Molecular weight240.30 g/mol
IUPAC nametert-butyl 3-hydroxyimino-8-azabicyclo[3.2.1]octane-8-carboxylate
InChIKeyQCPJJHMDEDMYKA-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1C2CCC1CC(=NO)C2

Computed by PubChem (NCBI)