CAS 913688-38-7 is the registry number for 9-(Methylthio)-5,6-dihydrothieno[3,4-h]quinazoline-2(1H)-thione, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
9-methylsulfanyl-5,6-dihydro-1H-thieno[3,4-h]quinazoline-2-thione (CAS 913688-38-7) is a chemical compound with the molecular formula C11H10N2S3 and a molecular weight of 266.4 g/mol. IUPAC name: 9-methylsulfanyl-5,6-dihydro-1H-thieno[3,4-h]quinazoline-2-thione. InChIKey: FEFSPUMIWMINDU-UHFFFAOYSA-N.
| Molecular formula | C11H10N2S3 |
|---|---|
| Molecular weight | 266.4 g/mol |
| IUPAC name | 9-methylsulfanyl-5,6-dihydro-1H-thieno[3,4-h]quinazoline-2-thione |
| InChIKey | FEFSPUMIWMINDU-UHFFFAOYSA-N |
| SMILES | CSC1=C2C(=CS1)CCC3=C2NC(=S)N=C3 |
Computed by PubChem (NCBI)