CAS 91383-15-2 is the registry number for (R)-3-Amino-3-cyclohexylpropanoic acid, 95%. Offered by: AmBeed. Available pack sizes: 1g.
(3R)-3-amino-3-cyclohexylpropanoic acid (CAS 91383-15-2) is a chemical compound with the molecular formula C9H17NO2 and a molecular weight of 171.24 g/mol. IUPAC name: (3R)-3-amino-3-cyclohexylpropanoic acid. InChIKey: XGRSAFKZAGGXJV-MRVPVSSYSA-N.
| Molecular formula | C9H17NO2 |
|---|---|
| Molecular weight | 171.24 g/mol |
| IUPAC name | (3R)-3-amino-3-cyclohexylpropanoic acid |
| InChIKey | XGRSAFKZAGGXJV-MRVPVSSYSA-N |
| SMILES | C1CCC(CC1)[C@@H](CC(=O)O)N |
Computed by PubChem (NCBI)