Products 913835-48-0

CAS 913835-48-0 is the registry number for 4-(N,N-Bis(4-methoxybenzyl)sulfamoyl)phenylboronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 1g.

Structural formula: {0} (CAS {1})

[4-[bis[(4-methoxyphenyl)methyl]sulfamoyl]phenyl]boronic acid (CAS 913835-48-0) is a chemical compound with the molecular formula C22H24BNO6S and a molecular weight of 441.3 g/mol. IUPAC name: [4-[bis[(4-methoxyphenyl)methyl]sulfamoyl]phenyl]boronic acid. InChIKey: RIXQVRAJIJXTLD-UHFFFAOYSA-N.

Identity
Molecular formulaC22H24BNO6S
Molecular weight441.3 g/mol
IUPAC name[4-[bis[(4-methoxyphenyl)methyl]sulfamoyl]phenyl]boronic acid
InChIKeyRIXQVRAJIJXTLD-UHFFFAOYSA-N
SMILESB(C1=CC=C(C=C1)S(=O)(=O)N(CC2=CC=C(C=C2)OC)CC3=CC=C(C=C3)OC)(O)O

Computed by PubChem (NCBI)