CAS 913835-49-1 is the registry number for 3-Fluoro-4-((4-methoxybenzyloxy)carbamoyl)phenylboronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
[3-fluoro-4-[(4-methoxyphenyl)methoxycarbamoyl]phenyl]boronic acid (CAS 913835-49-1) is a chemical compound with the molecular formula C15H15BFNO5 and a molecular weight of 319.09 g/mol. IUPAC name: [3-fluoro-4-[(4-methoxyphenyl)methoxycarbamoyl]phenyl]boronic acid. InChIKey: SZEGRCMHYGEWJC-UHFFFAOYSA-N.
| Molecular formula | C15H15BFNO5 |
|---|---|
| Molecular weight | 319.09 g/mol |
| IUPAC name | [3-fluoro-4-[(4-methoxyphenyl)methoxycarbamoyl]phenyl]boronic acid |
| InChIKey | SZEGRCMHYGEWJC-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C(=O)NOCC2=CC=C(C=C2)OC)F)(O)O |
Computed by PubChem (NCBI)