CAS 913835-52-6 appears in our catalog under these names: 4-(N-Acetylsulfamoyl)phenylboronic acid, 98%, (4-(N-Acetylsulfamoyl)phenyl)boronic acid, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 250mg, 100mg.
[4-(acetylsulfamoyl)phenyl]boronic acid (CAS 913835-52-6) is a chemical compound with the molecular formula C8H10BNO5S and a molecular weight of 243.05 g/mol. IUPAC name: [4-(acetylsulfamoyl)phenyl]boronic acid. InChIKey: CEUUKZMDDOCDTD-UHFFFAOYSA-N.
| Molecular formula | C8H10BNO5S |
|---|---|
| Molecular weight | 243.05 g/mol |
| IUPAC name | [4-(acetylsulfamoyl)phenyl]boronic acid |
| InChIKey | CEUUKZMDDOCDTD-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)S(=O)(=O)NC(=O)C)(O)O |
Computed by PubChem (NCBI)