CAS 913835-53-7 appears in our catalog under these names: 4-(N-(2-(TBDMSO)ethyl)sulfamoyl)phenylboronic acid, 95%, (4-(N-(2-((tert-Butyldimethylsilyl)oxy)ethyl)sulfamoyl)phenyl)boronic acid, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
[4-[2-[tert-butyl(dimethyl)silyl]oxyethylsulfamoyl]phenyl]boronic acid (CAS 913835-53-7) is a chemical compound with the molecular formula C14H26BNO5SSi and a molecular weight of 359.3 g/mol. IUPAC name: [4-[2-[tert-butyl(dimethyl)silyl]oxyethylsulfamoyl]phenyl]boronic acid. InChIKey: LYIHSUDDNJJGBY-UHFFFAOYSA-N.
| Molecular formula | C14H26BNO5SSi |
|---|---|
| Molecular weight | 359.3 g/mol |
| IUPAC name | [4-[2-[tert-butyl(dimethyl)silyl]oxyethylsulfamoyl]phenyl]boronic acid |
| InChIKey | LYIHSUDDNJJGBY-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)S(=O)(=O)NCCO[Si](C)(C)C(C)(C)C)(O)O |
Computed by PubChem (NCBI)