CAS 913835-57-1 appears in our catalog under these names: N-(2-Hydroxyethyl) 3-boronobenzenesulfonamide, 97%, N-(2-Hydroxyethyl) 3-boronobenzenesulfonamide. Offered by: Combi-blocks, TRC. Available pack sizes: 1g, 250mg, 2,5g.
[3-(2-hydroxyethylsulfamoyl)phenyl]boronic acid (CAS 913835-57-1) is a chemical compound with the molecular formula C8H12BNO5S and a molecular weight of 245.07 g/mol. IUPAC name: [3-(2-hydroxyethylsulfamoyl)phenyl]boronic acid. InChIKey: HSOUGLHWSPWPOM-UHFFFAOYSA-N.
| Molecular formula | C8H12BNO5S |
|---|---|
| Molecular weight | 245.07 g/mol |
| IUPAC name | [3-(2-hydroxyethylsulfamoyl)phenyl]boronic acid |
| InChIKey | HSOUGLHWSPWPOM-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)S(=O)(=O)NCCO)(O)O |
Computed by PubChem (NCBI)