Products 913835-78-6

CAS 913835-78-6 is the registry number for 3-(Benzylamino)-5-nitrophenylboronic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 25g, 1g.

Structural formula: {0} (CAS {1})

[3-(benzylamino)-5-nitrophenyl]boronic acid;hydrochloride (CAS 913835-78-6) is a chemical compound with the molecular formula C13H14BClN2O4 and a molecular weight of 308.53 g/mol. IUPAC name: [3-(benzylamino)-5-nitrophenyl]boronic acid;hydrochloride. InChIKey: YSXGPPOSKCOXDK-UHFFFAOYSA-N.

Identity
Molecular formulaC13H14BClN2O4
Molecular weight308.53 g/mol
IUPAC name[3-(benzylamino)-5-nitrophenyl]boronic acid;hydrochloride
InChIKeyYSXGPPOSKCOXDK-UHFFFAOYSA-N
SMILESB(C1=CC(=CC(=C1)[N+](=O)[O-])NCC2=CC=CC=C2)(O)O.Cl

Computed by PubChem (NCBI)