CAS 913835-78-6 is the registry number for 3-(Benzylamino)-5-nitrophenylboronic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 25g, 1g.
[3-(benzylamino)-5-nitrophenyl]boronic acid;hydrochloride (CAS 913835-78-6) is a chemical compound with the molecular formula C13H14BClN2O4 and a molecular weight of 308.53 g/mol. IUPAC name: [3-(benzylamino)-5-nitrophenyl]boronic acid;hydrochloride. InChIKey: YSXGPPOSKCOXDK-UHFFFAOYSA-N.
| Molecular formula | C13H14BClN2O4 |
|---|---|
| Molecular weight | 308.53 g/mol |
| IUPAC name | [3-(benzylamino)-5-nitrophenyl]boronic acid;hydrochloride |
| InChIKey | YSXGPPOSKCOXDK-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)[N+](=O)[O-])NCC2=CC=CC=C2)(O)O.Cl |
Computed by PubChem (NCBI)