CAS 913835-89-9 appears in our catalog under these names: 4-[N-Cyclopropyl-N-(4-methoxybenzyl)sulfamoyl]phenylboronic acid, 98%, (4-(N-Cyclopropyl-N-(4-methoxybenzyl)sulfamoyl)phenyl)boronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 25g, 1g.
[4-[cyclopropyl-[(4-methoxyphenyl)methyl]sulfamoyl]phenyl]boronic acid (CAS 913835-89-9) is a chemical compound with the molecular formula C17H20BNO5S and a molecular weight of 361.2 g/mol. IUPAC name: [4-[cyclopropyl-[(4-methoxyphenyl)methyl]sulfamoyl]phenyl]boronic acid. InChIKey: BMBKRBBFPKRYSF-UHFFFAOYSA-N.
| Molecular formula | C17H20BNO5S |
|---|---|
| Molecular weight | 361.2 g/mol |
| IUPAC name | [4-[cyclopropyl-[(4-methoxyphenyl)methyl]sulfamoyl]phenyl]boronic acid |
| InChIKey | BMBKRBBFPKRYSF-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)S(=O)(=O)N(CC2=CC=C(C=C2)OC)C3CC3)(O)O |
Computed by PubChem (NCBI)