CAS 913835-95-7 is the registry number for 4-(N-Benzyl-N-(4-methoxybenzyl)sulfamoyl)phenylboronic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 25g, 1g.
[4-[benzyl-[(4-methoxyphenyl)methyl]sulfamoyl]phenyl]boronic acid (CAS 913835-95-7) is a chemical compound with the molecular formula C21H22BNO5S and a molecular weight of 411.3 g/mol. IUPAC name: [4-[benzyl-[(4-methoxyphenyl)methyl]sulfamoyl]phenyl]boronic acid. InChIKey: KVYLYENGQVBOPD-UHFFFAOYSA-N.
| Molecular formula | C21H22BNO5S |
|---|---|
| Molecular weight | 411.3 g/mol |
| IUPAC name | [4-[benzyl-[(4-methoxyphenyl)methyl]sulfamoyl]phenyl]boronic acid |
| InChIKey | KVYLYENGQVBOPD-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)S(=O)(=O)N(CC2=CC=CC=C2)CC3=CC=C(C=C3)OC)(O)O |
Computed by PubChem (NCBI)