CAS 913835-96-8 is the registry number for 4-(N-Isopropyl-N-(4-methoxybenzyl)sulfamoyl)phenylboronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 100g, 1g.
[4-[(4-methoxyphenyl)methyl-propan-2-ylsulfamoyl]phenyl]boronic acid (CAS 913835-96-8) is a chemical compound with the molecular formula C17H22BNO5S and a molecular weight of 363.2 g/mol. IUPAC name: [4-[(4-methoxyphenyl)methyl-propan-2-ylsulfamoyl]phenyl]boronic acid. InChIKey: YCTUMPATZIWTLB-UHFFFAOYSA-N.
| Molecular formula | C17H22BNO5S |
|---|---|
| Molecular weight | 363.2 g/mol |
| IUPAC name | [4-[(4-methoxyphenyl)methyl-propan-2-ylsulfamoyl]phenyl]boronic acid |
| InChIKey | YCTUMPATZIWTLB-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)S(=O)(=O)N(CC2=CC=C(C=C2)OC)C(C)C)(O)O |
Computed by PubChem (NCBI)