Products 913836-13-2

CAS 913836-13-2 is the registry number for 4-(N-Cyclohexyl-N-(4-methoxybenzyl)sulfamoyl)phenylboronic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 25g, 1g.

Structural formula: {0} (CAS {1})

[4-[cyclohexyl-[(4-methoxyphenyl)methyl]sulfamoyl]phenyl]boronic acid (CAS 913836-13-2) is a chemical compound with the molecular formula C20H26BNO5S and a molecular weight of 403.3 g/mol. IUPAC name: [4-[cyclohexyl-[(4-methoxyphenyl)methyl]sulfamoyl]phenyl]boronic acid. InChIKey: NRLGPZDODJYKCR-UHFFFAOYSA-N.

Identity
Molecular formulaC20H26BNO5S
Molecular weight403.3 g/mol
IUPAC name[4-[cyclohexyl-[(4-methoxyphenyl)methyl]sulfamoyl]phenyl]boronic acid
InChIKeyNRLGPZDODJYKCR-UHFFFAOYSA-N
SMILESB(C1=CC=C(C=C1)S(=O)(=O)N(CC2=CC=C(C=C2)OC)C3CCCCC3)(O)O

Computed by PubChem (NCBI)