CAS 914-20-5 is the registry number for [1,1'-Bianthracene]-9,9',10,10'-tetraone, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(9,10-dioxoanthracen-1-yl)anthracene-9,10-dione (CAS 914-20-5) is a chemical compound with the molecular formula C28H14O4 and a molecular weight of 414.4 g/mol. IUPAC name: 1-(9,10-dioxoanthracen-1-yl)anthracene-9,10-dione. InChIKey: SZKSKYDUWNZBPR-UHFFFAOYSA-N.
| Molecular formula | C28H14O4 |
|---|---|
| Molecular weight | 414.4 g/mol |
| IUPAC name | 1-(9,10-dioxoanthracen-1-yl)anthracene-9,10-dione |
| InChIKey | SZKSKYDUWNZBPR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=CC=CC(=C3C2=O)C4=C5C(=CC=C4)C(=O)C6=CC=CC=C6C5=O |
Computed by PubChem (NCBI)