CAS 91400-18-9 is the registry number for Xylaric acid disodium salt. Offered by: Biosynth. Available pack sizes: 100mg, 50mg, 250mg.
Disodium;(2R,4S)-2,3,4-trihydroxypentanedioate (CAS 91400-18-9) is a chemical compound with the molecular formula C5H6Na2O7 and a molecular weight of 224.08 g/mol. IUPAC name: disodium;(2R,4S)-2,3,4-trihydroxypentanedioate. InChIKey: XWSQGJPHMLUZEL-MLFDNCOYSA-L.
| Molecular formula | C5H6Na2O7 |
|---|---|
| Molecular weight | 224.08 g/mol |
| IUPAC name | disodium;(2R,4S)-2,3,4-trihydroxypentanedioate |
| InChIKey | XWSQGJPHMLUZEL-MLFDNCOYSA-L |
| SMILES | [C@@H](C([C@@H](C(=O)[O-])O)O)(C(=O)[O-])O.[Na+].[Na+] |
Computed by PubChem (NCBI)