CAS 91407-48-6 is the registry number for (2-Fluoro-4,5-dimethoxybenzyl)chloride. Offered by: TRC. Available pack sizes: 5g.
1-(chloromethyl)-2-fluoro-4,5-dimethoxybenzene (CAS 91407-48-6) is a chemical compound with the molecular formula C9H10ClFO2 and a molecular weight of 204.62 g/mol. IUPAC name: 1-(chloromethyl)-2-fluoro-4,5-dimethoxybenzene. InChIKey: FKDJCJSSPNZLOR-UHFFFAOYSA-N.
| Molecular formula | C9H10ClFO2 |
|---|---|
| Molecular weight | 204.62 g/mol |
| IUPAC name | 1-(chloromethyl)-2-fluoro-4,5-dimethoxybenzene |
| InChIKey | FKDJCJSSPNZLOR-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)CCl)F)OC |
Computed by PubChem (NCBI)