Products 914203-49-9
CAS 914203-49-9 is the registry number for ATTO 390. Offered by: MedChemExpress. Available pack sizes: 10 mg, 5 mg, 25 mg.
4-(4,6,8,8-tetramethyl-2-oxo-6,7-dihydropyrano[3,2-g]quinolin-9-yl)butanoic acid (CAS 914203-49-9) is a chemical compound with the molecular formula C20H25NO4 and a molecular weight of 343.4 g/mol. IUPAC name: 4-(4,6,8,8-tetramethyl-2-oxo-6,7-dihydropyrano[3,2-g]quinolin-9-yl)butanoic acid. InChIKey: CORGJZNTIXXSQK-UHFFFAOYSA-N.
| Molecular formula | C20H25NO4 |
|---|---|
| Molecular weight | 343.4 g/mol |
| IUPAC name | 4-(4,6,8,8-tetramethyl-2-oxo-6,7-dihydropyrano[3,2-g]quinolin-9-yl)butanoic acid |
| InChIKey | CORGJZNTIXXSQK-UHFFFAOYSA-N |
| SMILES | CC1CC(N(C2=C1C=C3C(=CC(=O)OC3=C2)C)CCCC(=O)O)(C)C |
Computed by PubChem (NCBI)