Products 914224-29-6
CAS 914224-29-6 appears in our catalog under these names: 4-Tert-Butyl 1-Methyl 2-Bromosuccinate, 95%, 95%, 4-(tert-Butyl) 1-methyl 2-bromosuccinate, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g.
4-O-tert-butyl 1-O-methyl 2-bromobutanedioate (CAS 914224-29-6) is a chemical compound with the molecular formula C9H15BrO4 and a molecular weight of 267.12 g/mol. IUPAC name: 4-O-tert-butyl 1-O-methyl 2-bromobutanedioate. InChIKey: RMYNMVDLUFHECX-UHFFFAOYSA-N.
| Molecular formula | C9H15BrO4 |
|---|---|
| Molecular weight | 267.12 g/mol |
| IUPAC name | 4-O-tert-butyl 1-O-methyl 2-bromobutanedioate |
| InChIKey | RMYNMVDLUFHECX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CC(C(=O)OC)Br |
Computed by PubChem (NCBI)