CAS 91424-40-7 appears in our catalog under these names: 4-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]dihydro-2H-pyran-2,6(3H)-dione, 98%, 98%, 3-(tert-Butyldimethylsilyloxy)glutaric anhydride, 95%, 3-(tert-Butyldimethylsilyloxy)glutaric anhydride, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 10g, 25g.
4-[tert-butyl(dimethyl)silyl]oxyoxane-2,6-dione (CAS 91424-40-7) is a chemical compound with the molecular formula C11H20O4Si and a molecular weight of 244.36 g/mol. IUPAC name: 4-[tert-butyl(dimethyl)silyl]oxyoxane-2,6-dione. InChIKey: RXAJGRHLLRGVSB-UHFFFAOYSA-N.
| Molecular formula | C11H20O4Si |
|---|---|
| Molecular weight | 244.36 g/mol |
| IUPAC name | 4-[tert-butyl(dimethyl)silyl]oxyoxane-2,6-dione |
| InChIKey | RXAJGRHLLRGVSB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC1CC(=O)OC(=O)C1 |
Computed by PubChem (NCBI)