Products 914299-12-0
CAS 914299-12-0 is the registry number for 5-(4-Bromo-2-methylphenyl)-3,4-dihydro-2H-pyrrole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(4-bromo-2-methylphenyl)-3,4-dihydro-2H-pyrrole (CAS 914299-12-0) is a chemical compound with the molecular formula C11H12BrN and a molecular weight of 238.12 g/mol. IUPAC name: 5-(4-bromo-2-methylphenyl)-3,4-dihydro-2H-pyrrole. InChIKey: KVGCSTQWXRMABP-UHFFFAOYSA-N.
| Molecular formula | C11H12BrN |
|---|---|
| Molecular weight | 238.12 g/mol |
| IUPAC name | 5-(4-bromo-2-methylphenyl)-3,4-dihydro-2H-pyrrole |
| InChIKey | KVGCSTQWXRMABP-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)Br)C2=NCCC2 |
Computed by PubChem (NCBI)