Products 914349-73-8

CAS 914349-73-8 is the registry number for (2-Amino-5-bromothiazol-4-yl)oxoacetic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

Methyl 2-(2-amino-5-bromo-1,3-thiazol-4-yl)-2-oxoacetate (CAS 914349-73-8) is a chemical compound with the molecular formula C6H5BrN2O3S and a molecular weight of 265.09 g/mol. IUPAC name: methyl 2-(2-amino-5-bromo-1,3-thiazol-4-yl)-2-oxoacetate. InChIKey: IVRWHXFNQUHDPQ-UHFFFAOYSA-N.

Identity
Molecular formulaC6H5BrN2O3S
Molecular weight265.09 g/mol
IUPAC namemethyl 2-(2-amino-5-bromo-1,3-thiazol-4-yl)-2-oxoacetate
InChIKeyIVRWHXFNQUHDPQ-UHFFFAOYSA-N
SMILESCOC(=O)C(=O)C1=C(SC(=N1)N)Br

Computed by PubChem (NCBI)