CAS 914454-08-3 appears in our catalog under these names: Sodium 2-boronobenzoate 98%, Benzoic acid, 2-borono-, sodium salt (1:1), 98%, 98%. Offered by: Ambeed, Chemat. Available pack sizes: 1g, 5g, 25g, 100g.
Sodium 2-boronobenzoate (CAS 914454-08-3) is a chemical compound with the molecular formula C7H6BNaO4 and a molecular weight of 187.92 g/mol. IUPAC name: sodium 2-boronobenzoate. InChIKey: SPMRNQMJDFHGCO-UHFFFAOYSA-M.
| Molecular formula | C7H6BNaO4 |
|---|---|
| Molecular weight | 187.92 g/mol |
| IUPAC name | sodium 2-boronobenzoate |
| InChIKey | SPMRNQMJDFHGCO-UHFFFAOYSA-M |
| SMILES | B(C1=CC=CC=C1C(=O)[O-])(O)O.[Na+] |
Computed by PubChem (NCBI)