CAS 91447-38-0 appears in our catalog under these names: 2-(-2((5-Nitro-2-furanyl)methylene)hydrazinyl)acetic Acid, >95% (HPLC), 2-(2-((5-Nitro-2-furanyl)methylene)hydrazinyl)acetic acid. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 1g.
2-[(2E)-2-[(5-nitrofuran-2-yl)methylidene]hydrazinyl]acetic acid (CAS 91447-38-0) is a chemical compound with the molecular formula C7H7N3O5 and a molecular weight of 213.15 g/mol. IUPAC name: 2-[(2E)-2-[(5-nitrofuran-2-yl)methylidene]hydrazinyl]acetic acid. InChIKey: YVUZTCSWXFILQY-FPYGCLRLSA-N.
| Molecular formula | C7H7N3O5 |
|---|---|
| Molecular weight | 213.15 g/mol |
| IUPAC name | 2-[(2E)-2-[(5-nitrofuran-2-yl)methylidene]hydrazinyl]acetic acid |
| InChIKey | YVUZTCSWXFILQY-FPYGCLRLSA-N |
| SMILES | C1=C(OC(=C1)[N+](=O)[O-])/C=N/NCC(=O)O |
Computed by PubChem (NCBI)