CAS 914480-48-1 is the registry number for Lisdexamphetamine Dihydrochloride, >95% (HPLC). Offered by: TRC. Available pack sizes: 1mg, 2,5mg, 25mg.
(2S)-2,6-diamino-N-[(2S)-1-phenylpropan-2-yl]hexanamide;dihydrochloride (CAS 914480-48-1) is a chemical compound with the molecular formula C15H27Cl2N3O and a molecular weight of 336.3 g/mol. IUPAC name: (2S)-2,6-diamino-N-[(2S)-1-phenylpropan-2-yl]hexanamide;dihydrochloride. InChIKey: MBFYQIVPCPSYQM-FORAGAHYSA-N.
| Molecular formula | C15H27Cl2N3O |
|---|---|
| Molecular weight | 336.3 g/mol |
| IUPAC name | (2S)-2,6-diamino-N-[(2S)-1-phenylpropan-2-yl]hexanamide;dihydrochloride |
| InChIKey | MBFYQIVPCPSYQM-FORAGAHYSA-N |
| SMILES | C[C@@H](CC1=CC=CC=C1)NC(=O)[C@H](CCCCN)N.Cl.Cl |
Computed by PubChem (NCBI)