CAS 914610-70-1 is the registry number for 4–(1,4–Dioxa–8–azaspiro(4·5)decan–8–ylsulfonyl)phenylboronic acid. Offered by: GLPBio. Available pack sizes: 1g.
[4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylsulfonyl)phenyl]boronic acid (CAS 914610-70-1) is a chemical compound with the molecular formula C13H18BNO6S and a molecular weight of 327.2 g/mol. IUPAC name: [4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylsulfonyl)phenyl]boronic acid. InChIKey: LNNPNTBNMRFMPQ-UHFFFAOYSA-N.
| Molecular formula | C13H18BNO6S |
|---|---|
| Molecular weight | 327.2 g/mol |
| IUPAC name | [4-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylsulfonyl)phenyl]boronic acid |
| InChIKey | LNNPNTBNMRFMPQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)S(=O)(=O)N2CCC3(CC2)OCCO3)(O)O |
Computed by PubChem (NCBI)