CAS 914626-65-6 appears in our catalog under these names: Bendamustine Impurity 16, Bendamustine Impurity 80, 1,3-Bis(1-methyl-5-nitro-1H-benzo(d)imidazol-2-yl)propane. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 50mg.
1-methyl-2-[3-(1-methyl-5-nitrobenzimidazol-2-yl)propyl]-5-nitrobenzimidazole (CAS 914626-65-6) is a chemical compound with the molecular formula C19H18N6O4 and a molecular weight of 394.4 g/mol. IUPAC name: 1-methyl-2-[3-(1-methyl-5-nitrobenzimidazol-2-yl)propyl]-5-nitrobenzimidazole. InChIKey: MXDPLCVHNNROGX-UHFFFAOYSA-N.
| Molecular formula | C19H18N6O4 |
|---|---|
| Molecular weight | 394.4 g/mol |
| IUPAC name | 1-methyl-2-[3-(1-methyl-5-nitrobenzimidazol-2-yl)propyl]-5-nitrobenzimidazole |
| InChIKey | MXDPLCVHNNROGX-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)[N+](=O)[O-])N=C1CCCC3=NC4=C(N3C)C=CC(=C4)[N+](=O)[O-] |
Computed by PubChem (NCBI)