CAS 914635-67-9 appears in our catalog under these names: 2,6-Dibromo-4-(trifluoromethoxy)phenol, 95%, 2,6-Dibromo-4-(trifluoromethoxy)phenol, 95+%, 2,6-Dibromo-4-(trifluoromethoxy)phenol. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
2,6-dibromo-4-(trifluoromethoxy)phenol (CAS 914635-67-9) is a chemical compound with the molecular formula C7H3Br2F3O2 and a molecular weight of 335.90 g/mol. IUPAC name: 2,6-dibromo-4-(trifluoromethoxy)phenol. InChIKey: ASLQYTWSSMJOND-UHFFFAOYSA-N.
| Molecular formula | C7H3Br2F3O2 |
|---|---|
| Molecular weight | 335.90 g/mol |
| IUPAC name | 2,6-dibromo-4-(trifluoromethoxy)phenol |
| InChIKey | ASLQYTWSSMJOND-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Br)O)Br)OC(F)(F)F |
Computed by PubChem (NCBI)