CAS 914637-43-7 is the registry number for 1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl 2-methylpropanoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl] 2-methylpropanoate (CAS 914637-43-7) is a chemical compound with the molecular formula C8H7F9O2 and a molecular weight of 306.13 g/mol. IUPAC name: [1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl] 2-methylpropanoate. InChIKey: SYZHJJUWVLPDLN-UHFFFAOYSA-N.
| Molecular formula | C8H7F9O2 |
|---|---|
| Molecular weight | 306.13 g/mol |
| IUPAC name | [1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl] 2-methylpropanoate |
| InChIKey | SYZHJJUWVLPDLN-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)OC(C(F)(F)F)(C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)