CAS 914792-92-0 is the registry number for (R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(4-phenoxyphenyl)propanoic acid, 95%. Offered by: AmBeed. Available pack sizes: 250mg, 1g.
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-phenoxyphenyl)propanoic acid (CAS 914792-92-0) is a chemical compound with the molecular formula C30H25NO5 and a molecular weight of 479.5 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-phenoxyphenyl)propanoic acid. InChIKey: AREGUKFAPOBHGQ-MUUNZHRXSA-N.
| Molecular formula | C30H25NO5 |
|---|---|
| Molecular weight | 479.5 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-phenoxyphenyl)propanoic acid |
| InChIKey | AREGUKFAPOBHGQ-MUUNZHRXSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=C(C=C2)C[C@H](C(=O)O)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35 |
Computed by PubChem (NCBI)