CAS 914808-66-5 appears in our catalog under these names: (4-(3-Chlorophenyl)phenyl)-(1-pyrimidin-2-ylpiperidin-4-yl)methanone, LX-6171/ 97.06% (existing batch purity), LX-6171. Offered by: TRC, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 100mg, 1mg, 5mg, 10mg, 25mg, 50mg, 500mg, 200mg.
[4-(3-chlorophenyl)phenyl]-(1-pyrimidin-2-ylpiperidin-4-yl)methanone (CAS 914808-66-5) is a chemical compound with the molecular formula C22H20ClN3O and a molecular weight of 377.9 g/mol. IUPAC name: [4-(3-chlorophenyl)phenyl]-(1-pyrimidin-2-ylpiperidin-4-yl)methanone. InChIKey: VHTIWIZIPOXSNP-UHFFFAOYSA-N.
| Molecular formula | C22H20ClN3O |
|---|---|
| Molecular weight | 377.9 g/mol |
| IUPAC name | [4-(3-chlorophenyl)phenyl]-(1-pyrimidin-2-ylpiperidin-4-yl)methanone |
| InChIKey | VHTIWIZIPOXSNP-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1C(=O)C2=CC=C(C=C2)C3=CC(=CC=C3)Cl)C4=NC=CC=N4 |
Computed by PubChem (NCBI)