CAS 91488-21-0 is the registry number for 6-Methoxy-2-naphthylacetic acid (6-MNA) glucuronide. Offered by: Chemat Brand. Available pack sizes: on request.
(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[2-(6-methoxynaphthalen-2-yl)acetyl]oxyoxane-2-carboxylic acid (CAS 91488-21-0) is a chemical compound with the molecular formula C19H20O9 and a molecular weight of 392.4 g/mol. IUPAC name: (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[2-(6-methoxynaphthalen-2-yl)acetyl]oxyoxane-2-carboxylic acid. InChIKey: IPKOMFMTOUPAMM-YUAHOQAQSA-N.
| Molecular formula | C19H20O9 |
|---|---|
| Molecular weight | 392.4 g/mol |
| IUPAC name | (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-[2-(6-methoxynaphthalen-2-yl)acetyl]oxyoxane-2-carboxylic acid |
| InChIKey | IPKOMFMTOUPAMM-YUAHOQAQSA-N |
| SMILES | COC1=CC2=C(C=C1)C=C(C=C2)CC(=O)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)C(=O)O)O)O)O |
Computed by PubChem (NCBI)