CAS 914922-83-1 is the registry number for Methyl 1-C-(4-chlorophenyl)-α-D-glucopyranoside, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg.
(2S,3R,4S,5S,6R)-2-(4-chlorophenyl)-6-(hydroxymethyl)-2-methoxyoxane-3,4,5-triol (CAS 914922-83-1) is a chemical compound with the molecular formula C13H17ClO6 and a molecular weight of 304.72 g/mol. IUPAC name: (2S,3R,4S,5S,6R)-2-(4-chlorophenyl)-6-(hydroxymethyl)-2-methoxyoxane-3,4,5-triol. InChIKey: YCYZOHKCKIITCC-LBELIVKGSA-N.
| Molecular formula | C13H17ClO6 |
|---|---|
| Molecular weight | 304.72 g/mol |
| IUPAC name | (2S,3R,4S,5S,6R)-2-(4-chlorophenyl)-6-(hydroxymethyl)-2-methoxyoxane-3,4,5-triol |
| InChIKey | YCYZOHKCKIITCC-LBELIVKGSA-N |
| SMILES | CO[C@@]1([C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)