Products 91505-19-0
CAS 91505-19-0 is the registry number for LG 82-4-01. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-chloro-5-(2-imidazol-1-ylethoxy)thiophene-2-carboxylic acid;hydrochloride (CAS 91505-19-0) is a chemical compound with the molecular formula C10H10Cl2N2O3S and a molecular weight of 309.17 g/mol. IUPAC name: 4-chloro-5-(2-imidazol-1-ylethoxy)thiophene-2-carboxylic acid;hydrochloride. InChIKey: GPQCCNMZXMIFRS-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2N2O3S |
|---|---|
| Molecular weight | 309.17 g/mol |
| IUPAC name | 4-chloro-5-(2-imidazol-1-ylethoxy)thiophene-2-carboxylic acid;hydrochloride |
| InChIKey | GPQCCNMZXMIFRS-UHFFFAOYSA-N |
| SMILES | C1=CN(C=N1)CCOC2=C(C=C(S2)C(=O)O)Cl.Cl |
Computed by PubChem (NCBI)