CAS 915095-84-0 appears in our catalog under these names: Empagliflozin Impurity 134, (S)-(5-Bromo-2-chlorophenyl)(4-((tetrahydrofuran-3-yl)oxy)phenyl)methanone 95%, (S)-(5-Bromo-2-chlorophenyl)(4-((tetrahydrofuran-3-yl)oxy)phenyl)methanone, 98%, 98%, Empagliflozin impurity 83, 99.54%, Empagliflozin impurity 83 (Standard). Offered by: Chemat Brand, Ambeed, Chemat, MedChemExpress, Fluorochem. Available pack sizes: on request, 250mg, 1g, 5g, 25g, 100g, 100mg, 10 g.
(5-bromo-2-chlorophenyl)-[4-[(3S)-oxolan-3-yl]oxyphenyl]methanone (CAS 915095-84-0) is a chemical compound with the molecular formula C17H14BrClO3 and a molecular weight of 381.6 g/mol. IUPAC name: (5-bromo-2-chlorophenyl)-[4-[(3S)-oxolan-3-yl]oxyphenyl]methanone. InChIKey: DGMVPGOZCCHBQI-AWEZNQCLSA-N.
| Molecular formula | C17H14BrClO3 |
|---|---|
| Molecular weight | 381.6 g/mol |
| IUPAC name | (5-bromo-2-chlorophenyl)-[4-[(3S)-oxolan-3-yl]oxyphenyl]methanone |
| InChIKey | DGMVPGOZCCHBQI-AWEZNQCLSA-N |
| SMILES | C1COC[C@H]1OC2=CC=C(C=C2)C(=O)C3=C(C=CC(=C3)Br)Cl |
Computed by PubChem (NCBI)