Products 915134-71-3

CAS 915134-71-3 is the registry number for 2-Amino-3,3-bis(4-fluorophenyl)propanoic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2-amino-3,3-bis(4-fluorophenyl)propanoic acid;hydrochloride (CAS 915134-71-3) is a chemical compound with the molecular formula C15H14ClF2NO2 and a molecular weight of 313.72 g/mol. IUPAC name: 2-amino-3,3-bis(4-fluorophenyl)propanoic acid;hydrochloride. InChIKey: KCNSBDJGJCBWAY-UHFFFAOYSA-N.

Identity
Molecular formulaC15H14ClF2NO2
Molecular weight313.72 g/mol
IUPAC name2-amino-3,3-bis(4-fluorophenyl)propanoic acid;hydrochloride
InChIKeyKCNSBDJGJCBWAY-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C(C2=CC=C(C=C2)F)C(C(=O)O)N)F.Cl

Computed by PubChem (NCBI)