CAS 915134-71-3 is the registry number for 2-Amino-3,3-bis(4-fluorophenyl)propanoic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-amino-3,3-bis(4-fluorophenyl)propanoic acid;hydrochloride (CAS 915134-71-3) is a chemical compound with the molecular formula C15H14ClF2NO2 and a molecular weight of 313.72 g/mol. IUPAC name: 2-amino-3,3-bis(4-fluorophenyl)propanoic acid;hydrochloride. InChIKey: KCNSBDJGJCBWAY-UHFFFAOYSA-N.
| Molecular formula | C15H14ClF2NO2 |
|---|---|
| Molecular weight | 313.72 g/mol |
| IUPAC name | 2-amino-3,3-bis(4-fluorophenyl)propanoic acid;hydrochloride |
| InChIKey | KCNSBDJGJCBWAY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C2=CC=C(C=C2)F)C(C(=O)O)N)F.Cl |
Computed by PubChem (NCBI)