Products 915282-45-0
CAS 915282-45-0 is the registry number for ATB-429. Offered by: MedChemExpress. Available pack sizes: Get quote.
[4-(5-sulfanylidenedithiol-3-yl)phenyl] 5-amino-2-hydroxybenzoate (CAS 915282-45-0) is a chemical compound with the molecular formula C16H11NO3S3 and a molecular weight of 361.5 g/mol. IUPAC name: [4-(5-sulfanylidenedithiol-3-yl)phenyl] 5-amino-2-hydroxybenzoate. InChIKey: DBDMFRBFYLANQK-UHFFFAOYSA-N.
| Molecular formula | C16H11NO3S3 |
|---|---|
| Molecular weight | 361.5 g/mol |
| IUPAC name | [4-(5-sulfanylidenedithiol-3-yl)phenyl] 5-amino-2-hydroxybenzoate |
| InChIKey | DBDMFRBFYLANQK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=S)SS2)OC(=O)C3=C(C=CC(=C3)N)O |
Computed by PubChem (NCBI)