Products 915376-75-9
CAS 915376-75-9 is the registry number for Ropinirole Impurity 8 Oxalate Salt. Offered by: Chemat Brand. Available pack sizes: on request.
Bis(2-(2-methyl-3-nitrophenyl)ethyl-dipropylazanium);oxalate (CAS 915376-75-9) is a chemical compound with the molecular formula C32H50N4O8 and a molecular weight of 618.8 g/mol. IUPAC name: bis(2-(2-methyl-3-nitrophenyl)ethyl-dipropylazanium);oxalate. InChIKey: BEHZEMYXVOHZCW-UHFFFAOYSA-N.
| Molecular formula | C32H50N4O8 |
|---|---|
| Molecular weight | 618.8 g/mol |
| IUPAC name | bis(2-(2-methyl-3-nitrophenyl)ethyl-dipropylazanium);oxalate |
| InChIKey | BEHZEMYXVOHZCW-UHFFFAOYSA-N |
| SMILES | CCC[NH+](CCC)CCC1=C(C(=CC=C1)[N+](=O)[O-])C.CCC[NH+](CCC)CCC1=C(C(=CC=C1)[N+](=O)[O-])C.C(=O)(C(=O)[O-])[O-] |
Computed by PubChem (NCBI)