CAS 91545-66-3 is the registry number for 2'-Nitro-[3,3'-bithiophene]-4-carbaldehyde, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(2-nitrothiophen-3-yl)thiophene-3-carbaldehyde (CAS 91545-66-3) is a chemical compound with the molecular formula C9H5NO3S2 and a molecular weight of 239.3 g/mol. IUPAC name: 4-(2-nitrothiophen-3-yl)thiophene-3-carbaldehyde. InChIKey: RZIYQUKMTLIYRM-UHFFFAOYSA-N.
| Molecular formula | C9H5NO3S2 |
|---|---|
| Molecular weight | 239.3 g/mol |
| IUPAC name | 4-(2-nitrothiophen-3-yl)thiophene-3-carbaldehyde |
| InChIKey | RZIYQUKMTLIYRM-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1C2=CSC=C2C=O)[N+](=O)[O-] |
Computed by PubChem (NCBI)