CAS 915720-70-6 appears in our catalog under these names: (S)-1-(5-Bromopyridin-2-yl)ethanamine 95%, (S)-1-(5-Bromopyridin-2-yl)ethanamine, 95%, 95%, (S)-1-(5-BROMOPYRIDIN-2-YL)ETHANAMINE, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 500mg.
(1S)-1-(5-bromo-2-pyridinyl)ethanamine (CAS 915720-70-6) is a chemical compound with the molecular formula C7H9BrN2 and a molecular weight of 201.06 g/mol. IUPAC name: (1S)-1-(5-bromo-2-pyridinyl)ethanamine. InChIKey: VKVGAVMRFMGWMB-YFKPBYRVSA-N.
| Molecular formula | C7H9BrN2 |
|---|---|
| Molecular weight | 201.06 g/mol |
| IUPAC name | (1S)-1-(5-bromo-2-pyridinyl)ethanamine |
| InChIKey | VKVGAVMRFMGWMB-YFKPBYRVSA-N |
| SMILES | C[C@@H](C1=NC=C(C=C1)Br)N |
Computed by PubChem (NCBI)