CAS 915750-92-4 is the registry number for N-Boc-3,3-diphenyl-D-alanine Benzyl ester, 97%. Offered by: AmBeed. Available pack sizes: 5g.
Benzyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3,3-diphenylpropanoate (CAS 915750-92-4) is a chemical compound with the molecular formula C27H29NO4 and a molecular weight of 431.5 g/mol. IUPAC name: benzyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3,3-diphenylpropanoate. InChIKey: XFISHIKNOUFXJK-XMMPIXPASA-N.
| Molecular formula | C27H29NO4 |
|---|---|
| Molecular weight | 431.5 g/mol |
| IUPAC name | benzyl (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3,3-diphenylpropanoate |
| InChIKey | XFISHIKNOUFXJK-XMMPIXPASA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](C(C1=CC=CC=C1)C2=CC=CC=C2)C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)