CAS 915772-85-9 is the registry number for (Ethyne–1,2–diylbis(4,1–phenylene))diboronic acid. Offered by: GLPBio. Available pack sizes: 1g.
[4-[2-(4-boronophenyl)ethynyl]phenyl]boronic acid (CAS 915772-85-9) is a chemical compound with the molecular formula C14H12B2O4 and a molecular weight of 265.9 g/mol. IUPAC name: [4-[2-(4-boronophenyl)ethynyl]phenyl]boronic acid. InChIKey: ZWEFBUWSPSPOIZ-UHFFFAOYSA-N.
| Molecular formula | C14H12B2O4 |
|---|---|
| Molecular weight | 265.9 g/mol |
| IUPAC name | [4-[2-(4-boronophenyl)ethynyl]phenyl]boronic acid |
| InChIKey | ZWEFBUWSPSPOIZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C#CC2=CC=C(C=C2)B(O)O)(O)O |
Computed by PubChem (NCBI)