Products 91587-01-8
CAS 91587-01-8 is the registry number for BASF 43915. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[(1E,3E,5E)-4-methyl-6-(2,6,6-trimethylcyclohexen-1-yl)hexa-1,3,5-trienyl]benzoic acid (CAS 91587-01-8) is a chemical compound with the molecular formula C23H28O2 and a molecular weight of 336.5 g/mol. IUPAC name: 4-[(1E,3E,5E)-4-methyl-6-(2,6,6-trimethylcyclohexen-1-yl)hexa-1,3,5-trienyl]benzoic acid. InChIKey: YRNAHKPMDMVFMV-GMICYETFSA-N.
| Molecular formula | C23H28O2 |
|---|---|
| Molecular weight | 336.5 g/mol |
| IUPAC name | 4-[(1E,3E,5E)-4-methyl-6-(2,6,6-trimethylcyclohexen-1-yl)hexa-1,3,5-trienyl]benzoic acid |
| InChIKey | YRNAHKPMDMVFMV-GMICYETFSA-N |
| SMILES | CC1=C(C(CCC1)(C)C)/C=C/C(=C/C=C/C2=CC=C(C=C2)C(=O)O)/C |
Computed by PubChem (NCBI)