CAS 915902-40-8 is the registry number for Methyl n-(3,4-difluorophenyl)-n-(methylsulfonyl)glycinate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl 2-(3,4-difluoro-N-methylsulfonylanilino)acetate (CAS 915902-40-8) is a chemical compound with the molecular formula C10H11F2NO4S and a molecular weight of 279.26 g/mol. IUPAC name: methyl 2-(3,4-difluoro-N-methylsulfonylanilino)acetate. InChIKey: ORJOBCFOXOREJW-UHFFFAOYSA-N.
| Molecular formula | C10H11F2NO4S |
|---|---|
| Molecular weight | 279.26 g/mol |
| IUPAC name | methyl 2-(3,4-difluoro-N-methylsulfonylanilino)acetate |
| InChIKey | ORJOBCFOXOREJW-UHFFFAOYSA-N |
| SMILES | COC(=O)CN(C1=CC(=C(C=C1)F)F)S(=O)(=O)C |
Computed by PubChem (NCBI)