CAS 915919-73-2 is the registry number for 2-(1-Naphthyl)pyrimidine-5-carbaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
2-naphthalen-1-ylpyrimidine-5-carbaldehyde (CAS 915919-73-2) is a chemical compound with the molecular formula C15H10N2O and a molecular weight of 234.25 g/mol. IUPAC name: 2-naphthalen-1-ylpyrimidine-5-carbaldehyde. InChIKey: PFXITZIWRQYRTP-UHFFFAOYSA-N.
| Molecular formula | C15H10N2O |
|---|---|
| Molecular weight | 234.25 g/mol |
| IUPAC name | 2-naphthalen-1-ylpyrimidine-5-carbaldehyde |
| InChIKey | PFXITZIWRQYRTP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2C3=NC=C(C=N3)C=O |
Computed by PubChem (NCBI)