Products 915919-81-2

CAS 915919-81-2 is the registry number for 1-(3-Methylpyridin-4-yl)-1,4-diazepane, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 50g, 1g, 5g.

Structural formula: {0} (CAS {1})

1-(3-methyl-4-pyridinyl)-1,4-diazepane (CAS 915919-81-2) is a chemical compound with the molecular formula C11H17N3 and a molecular weight of 191.27 g/mol. IUPAC name: 1-(3-methyl-4-pyridinyl)-1,4-diazepane. InChIKey: GGINBDYFBDUALM-UHFFFAOYSA-N.

Identity
Molecular formulaC11H17N3
Molecular weight191.27 g/mol
IUPAC name1-(3-methyl-4-pyridinyl)-1,4-diazepane
InChIKeyGGINBDYFBDUALM-UHFFFAOYSA-N
SMILESCC1=C(C=CN=C1)N2CCCNCC2

Computed by PubChem (NCBI)