CAS 915922-29-1 is the registry number for 4-[1-(Dimethylamino)ethyl]benzaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 10g, 1g.
4-[1-(dimethylamino)ethyl]benzaldehyde (CAS 915922-29-1) is a chemical compound with the molecular formula C11H15NO and a molecular weight of 177.24 g/mol. IUPAC name: 4-[1-(dimethylamino)ethyl]benzaldehyde. InChIKey: FFQIQLFXHDPNON-UHFFFAOYSA-N.
| Molecular formula | C11H15NO |
|---|---|
| Molecular weight | 177.24 g/mol |
| IUPAC name | 4-[1-(dimethylamino)ethyl]benzaldehyde |
| InChIKey | FFQIQLFXHDPNON-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(C=C1)C=O)N(C)C |
Computed by PubChem (NCBI)