Products 915922-69-9

CAS 915922-69-9 is the registry number for (5-[Morpholin-4-yl(phenyl)methyl]-1h-tetrazol-1-yl)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

2-[5-[morpholin-4-yl(phenyl)methyl]tetrazol-1-yl]acetic acid (CAS 915922-69-9) is a chemical compound with the molecular formula C14H17N5O3 and a molecular weight of 303.32 g/mol. IUPAC name: 2-[5-[morpholin-4-yl(phenyl)methyl]tetrazol-1-yl]acetic acid. InChIKey: WJCGZMJZBWYCBG-UHFFFAOYSA-N.

Identity
Molecular formulaC14H17N5O3
Molecular weight303.32 g/mol
IUPAC name2-[5-[morpholin-4-yl(phenyl)methyl]tetrazol-1-yl]acetic acid
InChIKeyWJCGZMJZBWYCBG-UHFFFAOYSA-N
SMILESC1COCCN1C(C2=CC=CC=C2)C3=NN=NN3CC(=O)O

Computed by PubChem (NCBI)