Products 915923-17-0
CAS 915923-17-0 appears in our catalog under these names: 5-Bromo-2-cyclopropyl-1,3-benzoxazole, 95%, 5-Bromo-2-cyclopropylbenzo(d)oxazole, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g, 250mg.
5-bromo-2-cyclopropyl-1,3-benzoxazole (CAS 915923-17-0) is a chemical compound with the molecular formula C10H8BrNO and a molecular weight of 238.08 g/mol. IUPAC name: 5-bromo-2-cyclopropyl-1,3-benzoxazole. InChIKey: JMMVKTYIPNMKOX-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO |
|---|---|
| Molecular weight | 238.08 g/mol |
| IUPAC name | 5-bromo-2-cyclopropyl-1,3-benzoxazole |
| InChIKey | JMMVKTYIPNMKOX-UHFFFAOYSA-N |
| SMILES | C1CC1C2=NC3=C(O2)C=CC(=C3)Br |
Computed by PubChem (NCBI)